C67H41N7O — CID 130288851
2',5'-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylspiro[indeno[2,1-b]carbazole-7,9'-xanthene] (PubChem CID 130288851) has the molecular formula C67H41N7O and a molecular weight of 960.11 g/mol. Its IUPAC name is 2',5'-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylspiro[indeno[2,1-b]carbazole-7,9'-xanthene].
| Compound Name | 2',5'-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylspiro[indeno[2,1-b]carbazole-7,9'-xanthene] |
|---|---|
| PubChem CID | 130288851 |
| Molecular Formula | C67H41N7O |
| Molecular Weight | 960.11 g/mol |
| Exact Mass | 959.34 |
| IUPAC Name | 2',5'-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylspiro[indeno[2,1-b]carbazole-7,9'-xanthene] |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C3(c5ccccc5-c5cc6c7ccccc7n(-c7ccccc7)c6cc53)c3cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c3O4)n2)cc1 |
| InChI | InChI=1S/C67H41N7O/c1-6-21-42(22-7-1)61-68-62(43-23-8-2-9-24-43)71-65(70-61)46-37-38-59-56(39-46)67(54-35-20-33-50(60(54)75-59)66-72-63(44-25-10-3-11-26-44)69-64(73-66)45-27-12-4-13-28-45)53-34-18-16-31-48(53)51-40-52-49-32-17-19-36-57(49)74(58(52)41-55(51)67)47-29-14-5-15-30-47/h1-41H |
| InChIKey | AMMMJWZLRQSHFH-UHFFFAOYSA-N |
| XLogP | 15.62 |
| TPSA | 91.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.11 |
| LogP ≤ 5 | 15.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |