C25H24N4O3 — CID 130289893
N-[[6-[(4-ethynylphenyl)carbamoyl]-6-azaspiro[2.5]octan-2-yl]methyl]furo[2,3-c]pyridine-2-carboxamide (PubChem CID 130289893) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[[6-[(4-ethynylphenyl)carbamoyl]-6-azaspiro[2.5]octan-2-yl]methyl]furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[[6-[(4-ethynylphenyl)carbamoyl]-6-azaspiro[2.5]octan-2-yl]methyl]furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130289893 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[[6-[(4-ethynylphenyl)carbamoyl]-6-azaspiro[2.5]octan-2-yl]methyl]furo[2,3-c]pyridine-2-carboxamide |
| SMILES | C#Cc1ccc(NC(=O)N2CCC3(CC2)CC3CNC(=O)c2cc3ccncc3o2)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-2-17-3-5-20(6-4-17)28-24(31)29-11-8-25(9-12-29)14-19(25)15-27-23(30)21-13-18-7-10-26-16-22(18)32-21/h1,3-7,10,13,16,19H,8-9,11-12,14-15H2,(H,27,30)(H,28,31) |
| InChIKey | HEDLQADGADKOSZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|