About 2-bromotetradeca-1,13-dien-4-ol
2-bromotetradeca-1,13-dien-4-ol (PubChem CID 13029018) has the molecular formula C14H25BrO
and a molecular weight of 289.26 g/mol. Its IUPAC name is 2-bromotetradeca-1,13-dien-4-ol.
Molecular Properties
| Compound Name | 2-bromotetradeca-1,13-dien-4-ol |
| PubChem CID | 13029018 |
| Molecular Formula | C14H25BrO |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-bromotetradeca-1,13-dien-4-ol |
| SMILES | C=CCCCCCCCCC(O)CC(=C)Br |
| InChI | InChI=1S/C14H25BrO/c1-3-4-5-6-7-8-9-10-11-14(16)12-13(2)15/h3,14,16H,1-2,4-12H2 |
| InChIKey | JRUWZYFHRZSREZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromotetradeca-1,13-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromotetradeca-1,13-dien-4-ol?
The IUPAC name of 2-bromotetradeca-1,13-dien-4-ol (CID 13029018) is 2-bromotetradeca-1,13-dien-4-ol.
What is the SMILES notation for 2-bromotetradeca-1,13-dien-4-ol?
The canonical SMILES for 2-bromotetradeca-1,13-dien-4-ol is C=CCCCCCCCCC(O)CC(=C)Br.
What is the InChIKey of 2-bromotetradeca-1,13-dien-4-ol?
The InChIKey is JRUWZYFHRZSREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25BrO/c1-3-4-5-6-7-8-9-10-11-14(16)12-13(2)15/h3,14,16H,1-2,4-12H2.
What are the key properties of 2-bromotetradeca-1,13-dien-4-ol?
2-bromotetradeca-1,13-dien-4-ol has a molecular weight of 289.26 g/mol, XLogP of 4.95, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromotetradeca-1,13-dien-4-ol is sourced from PubChem (CID 13029018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).