About 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde
6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde (PubChem CID 130290295) has the molecular formula C9H4BrNO3
and a molecular weight of 254.04 g/mol. Its IUPAC name is 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde |
| PubChem CID | 130290295 |
| Molecular Formula | C9H4BrNO3 |
| Molecular Weight | 254.04 g/mol |
| Exact Mass | 252.94 |
| IUPAC Name | 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1coc2ccc(Br)nc2c1=O |
| InChI | InChI=1S/C9H4BrNO3/c10-7-2-1-6-8(11-7)9(13)5(3-12)4-14-6/h1-4H |
| InChIKey | FKGFFLAYKKUNDH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.04 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde?
The IUPAC name of 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde (CID 130290295) is 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde.
What is the SMILES notation for 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde?
The canonical SMILES for 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde is O=Cc1coc2ccc(Br)nc2c1=O.
What is the InChIKey of 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde?
The InChIKey is FKGFFLAYKKUNDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrNO3/c10-7-2-1-6-8(11-7)9(13)5(3-12)4-14-6/h1-4H.
What are the key properties of 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde?
6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde has a molecular weight of 254.04 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-oxopyrano[3,2-b]pyridine-3-carbaldehyde is sourced from PubChem (CID 130290295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).