About (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate
(8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate (PubChem CID 130290529) has the molecular formula C24H17F3O5S
and a molecular weight of 474.46 g/mol. Its IUPAC name is (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate |
| PubChem CID | 130290529 |
| Molecular Formula | C24H17F3O5S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2c(c1)OC(c1ccccc1)C1=C2COc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C24H17F3O5S/c1-14-7-9-17-19-13-30-20-12-16(32-33(28,29)24(25,26)27)8-10-18(20)22(19)23(31-21(17)11-14)15-5-3-2-4-6-15/h2-12,23H,13H2,1H3 |
| InChIKey | RUFFWNWEZUESGF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate?
The IUPAC name of (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate (CID 130290529) is (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate.
What is the SMILES notation for (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate?
The canonical SMILES for (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate is Cc1ccc2c(c1)OC(c1ccccc1)C1=C2COc2cc(OS(=O)(=O)C(F)(F)F)ccc21.
What is the InChIKey of (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate?
The InChIKey is RUFFWNWEZUESGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F3O5S/c1-14-7-9-17-19-13-30-20-12-16(32-33(28,29)24(25,26)27)8-10-18(20)22(19)23(31-21(17)11-14)15-5-3-2-4-6-15/h2-12,23H,13H2,1H3.
What are the key properties of (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate?
(8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate has a molecular weight of 474.46 g/mol, XLogP of 5.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-5-phenyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate is sourced from PubChem (CID 130290529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).