About (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine
(Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine (PubChem CID 130290774) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine |
| PubChem CID | 130290774 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine |
| SMILES | C/C=C\C(=N\C(=C/N)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H24N2/c1-7-8-11(10(2)3)15-12(9-14)13(4,5)6/h7-10H,14H2,1-6H3/b8-7-,12-9-,15-11- |
| InChIKey | SWEACAZIRXDRGR-ADKHKFFASA-N |
| XLogP | 3.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine?
The IUPAC name of (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine (CID 130290774) is (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine.
What is the SMILES notation for (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine?
The canonical SMILES for (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine is C/C=C\C(=N\C(=C/N)C(C)(C)C)C(C)C.
What is the InChIKey of (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine?
The InChIKey is SWEACAZIRXDRGR-ADKHKFFASA-N. The full InChI is InChI=1S/C13H24N2/c1-7-8-11(10(2)3)15-12(9-14)13(4,5)6/h7-10H,14H2,1-6H3/b8-7-,12-9-,15-11-.
What are the key properties of (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine?
(Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine has a molecular weight of 208.35 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,3-dimethyl-2-[[(Z)-2-methylhex-4-en-3-ylidene]amino]but-1-en-1-amine is sourced from PubChem (CID 130290774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).