C15H10N2 — CID 130290898
12,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 130290898) has the molecular formula C15H10N2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 12,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 12,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 130290898 |
| Molecular Formula | C15H10N2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 12,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C1=CC2=c3ccccc3=CC3=CC=NC(=N1)C32 |
| InChI | InChI=1S/C15H10N2/c1-2-4-12-10(3-1)9-11-5-7-16-15-14(11)13(12)6-8-17-15/h1-9,14H |
| InChIKey | SMDQAOPHPCRXBM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |