About 7,8-dihydrobenzo[b][1,5]naphthyridine
7,8-dihydrobenzo[b][1,5]naphthyridine (PubChem CID 130290940) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is 7,8-dihydrobenzo[b][1,5]naphthyridine.
Molecular Properties
| Compound Name | 7,8-dihydrobenzo[b][1,5]naphthyridine |
| PubChem CID | 130290940 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 7,8-dihydrobenzo[b][1,5]naphthyridine |
| SMILES | C1=c2cc3ncccc3nc2=CCC1 |
| InChI | InChI=1S/C12H10N2/c1-2-5-10-9(4-1)8-12-11(14-10)6-3-7-13-12/h3-8H,1-2H2 |
| InChIKey | GUZLPCMEWCLJSL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-dihydrobenzo[b][1,5]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydrobenzo[b][1,5]naphthyridine?
The IUPAC name of 7,8-dihydrobenzo[b][1,5]naphthyridine (CID 130290940) is 7,8-dihydrobenzo[b][1,5]naphthyridine.
What is the SMILES notation for 7,8-dihydrobenzo[b][1,5]naphthyridine?
The canonical SMILES for 7,8-dihydrobenzo[b][1,5]naphthyridine is C1=c2cc3ncccc3nc2=CCC1.
What is the InChIKey of 7,8-dihydrobenzo[b][1,5]naphthyridine?
The InChIKey is GUZLPCMEWCLJSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2/c1-2-5-10-9(4-1)8-12-11(14-10)6-3-7-13-12/h3-8H,1-2H2.
What are the key properties of 7,8-dihydrobenzo[b][1,5]naphthyridine?
7,8-dihydrobenzo[b][1,5]naphthyridine has a molecular weight of 182.23 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydrobenzo[b][1,5]naphthyridine is sourced from PubChem (CID 130290940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).