About (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine
(3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine (PubChem CID 130291029) has the molecular formula C6H12F2N2
and a molecular weight of 150.17 g/mol. Its IUPAC name is (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine.
Molecular Properties
| Compound Name | (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine |
| PubChem CID | 130291029 |
| Molecular Formula | C6H12F2N2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine |
| SMILES | C=C(NCC(F)F)[C@@H](C)N |
| InChI | InChI=1S/C6H12F2N2/c1-4(9)5(2)10-3-6(7)8/h4,6,10H,2-3,9H2,1H3/t4-/m1/s1 |
| InChIKey | GLWQNMKAOCBIMJ-SCSAIBSYSA-N |
| XLogP | 0.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine?
The IUPAC name of (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine (CID 130291029) is (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine.
What is the SMILES notation for (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine?
The canonical SMILES for (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine is C=C(NCC(F)F)[C@@H](C)N.
What is the InChIKey of (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine?
The InChIKey is GLWQNMKAOCBIMJ-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H12F2N2/c1-4(9)5(2)10-3-6(7)8/h4,6,10H,2-3,9H2,1H3/t4-/m1/s1.
What are the key properties of (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine?
(3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine has a molecular weight of 150.17 g/mol, XLogP of 0.70, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-N-(2,2-difluoroethyl)but-1-ene-2,3-diamine is sourced from PubChem (CID 130291029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).