About (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane
(1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane (PubChem CID 130291086) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane |
| PubChem CID | 130291086 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane |
| SMILES | CC1(F)CC2CC(F)C[C@](C)(C1)N2O |
| InChI | InChI=1S/C10H17F2NO/c1-9(12)5-8-3-7(11)4-10(2,6-9)13(8)14/h7-8,14H,3-6H2,1-2H3/t7?,8?,9?,10-/m1/s1 |
| InChIKey | AWMKEAFEGQVIPR-SYZWKDNESA-N |
| XLogP | 2.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane?
The IUPAC name of (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane (CID 130291086) is (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane.
What is the SMILES notation for (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane?
The canonical SMILES for (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane is CC1(F)CC2CC(F)C[C@](C)(C1)N2O.
What is the InChIKey of (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane?
The InChIKey is AWMKEAFEGQVIPR-SYZWKDNESA-N. The full InChI is InChI=1S/C10H17F2NO/c1-9(12)5-8-3-7(11)4-10(2,6-9)13(8)14/h7-8,14H,3-6H2,1-2H3/t7?,8?,9?,10-/m1/s1.
What are the key properties of (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane?
(1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane has a molecular weight of 205.25 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3,7-difluoro-9-hydroxy-1,3-dimethyl-9-azabicyclo[3.3.1]nonane is sourced from PubChem (CID 130291086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).