About 11cH-phenaleno[1,2-c]pyridine
11cH-phenaleno[1,2-c]pyridine (PubChem CID 130291242) has the molecular formula C16H11N
and a molecular weight of 217.27 g/mol. Its IUPAC name is 11cH-phenaleno[1,2-c]pyridine.
Molecular Properties
| Compound Name | 11cH-phenaleno[1,2-c]pyridine |
| PubChem CID | 130291242 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 11cH-phenaleno[1,2-c]pyridine |
| SMILES | C1=CC2=CC=CC3=c4cnccc4=CC(=C1)C23 |
| InChI | InChI=1S/C16H11N/c1-3-11-4-2-6-14-15-10-17-8-7-12(15)9-13(5-1)16(11)14/h1-10,16H |
| InChIKey | LUMQXPHNFBFXIS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11cH-phenaleno[1,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11cH-phenaleno[1,2-c]pyridine?
The IUPAC name of 11cH-phenaleno[1,2-c]pyridine (CID 130291242) is 11cH-phenaleno[1,2-c]pyridine.
What is the SMILES notation for 11cH-phenaleno[1,2-c]pyridine?
The canonical SMILES for 11cH-phenaleno[1,2-c]pyridine is C1=CC2=CC=CC3=c4cnccc4=CC(=C1)C23.
What is the InChIKey of 11cH-phenaleno[1,2-c]pyridine?
The InChIKey is LUMQXPHNFBFXIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N/c1-3-11-4-2-6-14-15-10-17-8-7-12(15)9-13(5-1)16(11)14/h1-10,16H.
What are the key properties of 11cH-phenaleno[1,2-c]pyridine?
11cH-phenaleno[1,2-c]pyridine has a molecular weight of 217.27 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11cH-phenaleno[1,2-c]pyridine is sourced from PubChem (CID 130291242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).