C27H38N4O3S — CID 130291321
(2S)-N-[1-cyclohexyl-2-[(2S)-2-[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]-1,3-thiazol-2-yl]pyrrolidin-1-yl]-2-oxoethyl]-2-(methylamino)propanamide (PubChem CID 130291321) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is (2S)-N-[1-cyclohexyl-2-[(2S)-2-[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]-1,3-thiazol-2-yl]pyrrolidin-1-yl]-2-oxoethyl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[1-cyclohexyl-2-[(2S)-2-[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]-1,3-thiazol-2-yl]pyrrolidin-1-yl]-2-oxoethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 130291321 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | (2S)-N-[1-cyclohexyl-2-[(2S)-2-[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]-1,3-thiazol-2-yl]pyrrolidin-1-yl]-2-oxoethyl]-2-(methylamino)propanamide |
| SMILES | C=C/C=C\C(=C/C)C(=O)c1csc([C@@H]2CCCN2C(=O)C(NC(=O)[C@H](C)NC)C2CCCCC2)n1 |
| InChI | InChI=1S/C27H38N4O3S/c1-5-7-12-19(6-2)24(32)21-17-35-26(29-21)22-15-11-16-31(22)27(34)23(20-13-9-8-10-14-20)30-25(33)18(3)28-4/h5-7,12,17-18,20,22-23,28H,1,8-11,13-16H2,2-4H3,(H,30,33)/b12-7-,19-6+/t18-,22-,23?/m0/s1 |
| InChIKey | QEQFCGCQNHGOQW-RJVFOXCMSA-N |
| XLogP | 4.35 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|