About difluoromethane;1,1,2-trifluoroethene
difluoromethane;1,1,2-trifluoroethene (PubChem CID 130291411) has the molecular formula C3H3F5
and a molecular weight of 134.05 g/mol. Its IUPAC name is difluoromethane;1,1,2-trifluoroethene.
Molecular Properties
| Compound Name | difluoromethane;1,1,2-trifluoroethene |
| PubChem CID | 130291411 |
| Molecular Formula | C3H3F5 |
| Molecular Weight | 134.05 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | difluoromethane;1,1,2-trifluoroethene |
| SMILES | FC=C(F)F.FCF |
| InChI | InChI=1S/C2HF3.CH2F2/c3-1-2(4)5;2-1-3/h1H;1H2 |
| InChIKey | VGWPDGXTWKJBIP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.05 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze difluoromethane;1,1,2-trifluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethane;1,1,2-trifluoroethene?
The IUPAC name of difluoromethane;1,1,2-trifluoroethene (CID 130291411) is difluoromethane;1,1,2-trifluoroethene.
What is the SMILES notation for difluoromethane;1,1,2-trifluoroethene?
The canonical SMILES for difluoromethane;1,1,2-trifluoroethene is FC=C(F)F.FCF.
What is the InChIKey of difluoromethane;1,1,2-trifluoroethene?
The InChIKey is VGWPDGXTWKJBIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF3.CH2F2/c3-1-2(4)5;2-1-3/h1H;1H2.
What are the key properties of difluoromethane;1,1,2-trifluoroethene?
difluoromethane;1,1,2-trifluoroethene has a molecular weight of 134.05 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethane;1,1,2-trifluoroethene is sourced from PubChem (CID 130291411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).