About (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one
(5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one (PubChem CID 130291505) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one.
Molecular Properties
| Compound Name | (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one |
| PubChem CID | 130291505 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one |
| SMILES | CN1C2CC[C@@H]1CC1(CNC(=O)O1)C2 |
| InChI | InChI=1S/C10H16N2O2/c1-12-7-2-3-8(12)5-10(4-7)6-11-9(13)14-10/h7-8H,2-6H2,1H3,(H,11,13)/t7-,8?,10?/m1/s1 |
| InChIKey | OHEOCZWPNGEMHX-ZNFPMYQNSA-N |
| XLogP | 0.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one?
The IUPAC name of (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one (CID 130291505) is (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one.
What is the SMILES notation for (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one?
The canonical SMILES for (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one is CN1C2CC[C@@H]1CC1(CNC(=O)O1)C2.
What is the InChIKey of (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one?
The InChIKey is OHEOCZWPNGEMHX-ZNFPMYQNSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-12-7-2-3-8(12)5-10(4-7)6-11-9(13)14-10/h7-8H,2-6H2,1H3,(H,11,13)/t7-,8?,10?/m1/s1.
What are the key properties of (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one?
(5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one has a molecular weight of 196.25 g/mol, XLogP of 0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5'R)-8'-methylspiro[1,3-oxazolidine-5,3'-8-azabicyclo[3.2.1]octane]-2-one is sourced from PubChem (CID 130291505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).