C11H17NO — CID 130291942
(3E,5E)-6-(methoxymethyl)-N-methylocta-1,3,5,7-tetraen-3-amine (PubChem CID 130291942) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (3E,5E)-6-(methoxymethyl)-N-methylocta-1,3,5,7-tetraen-3-amine.
| Compound Name | (3E,5E)-6-(methoxymethyl)-N-methylocta-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 130291942 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3E,5E)-6-(methoxymethyl)-N-methylocta-1,3,5,7-tetraen-3-amine |
| SMILES | C=C/C(=C\C=C(/C=C)NC)COC |
| InChI | InChI=1S/C11H17NO/c1-5-10(9-13-4)7-8-11(6-2)12-3/h5-8,12H,1-2,9H2,3-4H3/b10-7+,11-8+ |
| InChIKey | BXIHHKZFVXZFAP-AMMQDNIMSA-N |
| XLogP | 2.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|