C22H21ClF6N2O3S — CID 130292084
(6R)-8-[2-chloro-5-[2,2,2-trifluoro-1-(3,4,5-trifluoroanilino)ethyl]phenyl]sulfonyl-6-methyl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 130292084) has the molecular formula C22H21ClF6N2O3S and a molecular weight of 542.93 g/mol. Its IUPAC name is (6R)-8-[2-chloro-5-[2,2,2-trifluoro-1-(3,4,5-trifluoroanilino)ethyl]phenyl]sulfonyl-6-methyl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (6R)-8-[2-chloro-5-[2,2,2-trifluoro-1-(3,4,5-trifluoroanilino)ethyl]phenyl]sulfonyl-6-methyl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 130292084 |
| Molecular Formula | C22H21ClF6N2O3S |
| Molecular Weight | 542.93 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | (6R)-8-[2-chloro-5-[2,2,2-trifluoro-1-(3,4,5-trifluoroanilino)ethyl]phenyl]sulfonyl-6-methyl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | C[C@@H]1CC2CC(O)CC1N2S(=O)(=O)c1cc(C(Nc2cc(F)c(F)c(F)c2)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C22H21ClF6N2O3S/c1-10-4-13-8-14(32)9-18(10)31(13)35(33,34)19-5-11(2-3-15(19)23)21(22(27,28)29)30-12-6-16(24)20(26)17(25)7-12/h2-3,5-7,10,13-14,18,21,30,32H,4,8-9H2,1H3/t10-,13?,14?,18?,21?/m1/s1 |
| InChIKey | PYKJTEFPFGWKKX-LUWYCFQQSA-N |
| XLogP | 5.40 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.93 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|