C35H41NO — CID 130292178
1-[(1S,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-4-tricyclo[7.3.1.02,7]trideca-2(7),3,5-trienyl]-4-[4-(6-methyl-3-pyridinyl)phenyl]butan-1-one (PubChem CID 130292178) has the molecular formula C35H41NO and a molecular weight of 491.72 g/mol. Its IUPAC name is 1-[(1S,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-4-tricyclo[7.3.1.02,7]trideca-2(7),3,5-trienyl]-4-[4-(6-methyl-3-pyridinyl)phenyl]butan-1-one.
| Compound Name | 1-[(1S,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-4-tricyclo[7.3.1.02,7]trideca-2(7),3,5-trienyl]-4-[4-(6-methyl-3-pyridinyl)phenyl]butan-1-one |
|---|---|
| PubChem CID | 130292178 |
| Molecular Formula | C35H41NO |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | 1-[(1S,13S)-10-(cyclopropylmethyl)-1,13-dimethyl-4-tricyclo[7.3.1.02,7]trideca-2(7),3,5-trienyl]-4-[4-(6-methyl-3-pyridinyl)phenyl]butan-1-one |
| SMILES | Cc1ccc(-c2ccc(CCCC(=O)c3ccc4c(c3)[C@@]3(C)CCC(CC5CC5)C(C4)[C@@H]3C)cc2)cn1 |
| InChI | InChI=1S/C35H41NO/c1-23-7-12-31(22-36-23)27-13-10-25(11-14-27)5-4-6-34(37)30-16-15-29-20-32-24(2)35(3,33(29)21-30)18-17-28(32)19-26-8-9-26/h7,10-16,21-22,24,26,28,32H,4-6,8-9,17-20H2,1-3H3/t24-,28?,32?,35-/m0/s1 |
| InChIKey | QANWEDUQALOLJV-JDELHHTMSA-N |
| XLogP | 8.54 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |