C17H9Cl3F4O — CID 130292396
2-chloro-4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]benzaldehyde (PubChem CID 130292396) has the molecular formula C17H9Cl3F4O and a molecular weight of 411.61 g/mol. Its IUPAC name is 2-chloro-4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]benzaldehyde.
| Compound Name | 2-chloro-4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]benzaldehyde |
|---|---|
| PubChem CID | 130292396 |
| Molecular Formula | C17H9Cl3F4O |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | 2-chloro-4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]benzaldehyde |
| SMILES | O=Cc1ccc(/C(F)=C/C(c2ccc(Cl)c(Cl)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H9Cl3F4O/c18-13-4-3-9(5-15(13)20)12(17(22,23)24)7-16(21)10-1-2-11(8-25)14(19)6-10/h1-8,12H/b16-7- |
| InChIKey | KGHYTIDEWBIGDP-APSNUPSMSA-N |
| XLogP | 7.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|