About 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine
1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine (PubChem CID 130292707) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine |
| PubChem CID | 130292707 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine |
| SMILES | C/C=C\C(=C/c1c(N)cnn1CC)CC |
| InChI | InChI=1S/C12H19N3/c1-4-7-10(5-2)8-12-11(13)9-14-15(12)6-3/h4,7-9H,5-6,13H2,1-3H3/b7-4-,10-8- |
| InChIKey | FHWSKVDWDMNCTF-NIQHGUSQSA-N |
| XLogP | 2.85 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine?
The IUPAC name of 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine (CID 130292707) is 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine.
What is the SMILES notation for 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine?
The canonical SMILES for 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine is C/C=C\C(=C/c1c(N)cnn1CC)CC.
What is the InChIKey of 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine?
The InChIKey is FHWSKVDWDMNCTF-NIQHGUSQSA-N. The full InChI is InChI=1S/C12H19N3/c1-4-7-10(5-2)8-12-11(13)9-14-15(12)6-3/h4,7-9H,5-6,13H2,1-3H3/b7-4-,10-8-.
What are the key properties of 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine?
1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine has a molecular weight of 205.31 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]pyrazol-4-amine is sourced from PubChem (CID 130292707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).