C19H23ClFN3O — CID 130293279
7-[(3R)-3-[(1S)-1-(chloroamino)ethyl]pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methylquinolin-2-one (PubChem CID 130293279) has the molecular formula C19H23ClFN3O and a molecular weight of 363.86 g/mol. Its IUPAC name is 7-[(3R)-3-[(1S)-1-(chloroamino)ethyl]pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methylquinolin-2-one.
| Compound Name | 7-[(3R)-3-[(1S)-1-(chloroamino)ethyl]pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methylquinolin-2-one |
|---|---|
| PubChem CID | 130293279 |
| Molecular Formula | C19H23ClFN3O |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 7-[(3R)-3-[(1S)-1-(chloroamino)ethyl]pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methylquinolin-2-one |
| SMILES | Cc1c(N2CC[C@@H]([C@H](C)NCl)C2)c(F)cc2ccc(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C19H23ClFN3O/c1-11-18-13(3-6-17(25)24(18)15-4-5-15)9-16(21)19(11)23-8-7-14(10-23)12(2)22-20/h3,6,9,12,14-15,22H,4-5,7-8,10H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | MCOPGKMCFGFOJW-GXTWGEPZSA-N |
| XLogP | 3.74 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|