C29H36N2O6 — CID 130293475
[(1R,4S,5S,6R,9S,10R,12R,14R)-5,6,15-trihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-methylimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 130293475) has the molecular formula C29H36N2O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is [(1R,4S,5S,6R,9S,10R,12R,14R)-5,6,15-trihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-methylimidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | [(1R,4S,5S,6R,9S,10R,12R,14R)-5,6,15-trihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-methylimidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 130293475 |
| Molecular Formula | C29H36N2O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | [(1R,4S,5S,6R,9S,10R,12R,14R)-5,6,15-trihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-methylimidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CC1=C[C@]23C(O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1c(C)nc2ccccn12)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C29H36N2O6/c1-14-12-28-15(2)10-19-21(27(19,4)5)18(24(28)34)11-17(13-32)23(33)29(28,36)25(14)37-26(35)22-16(3)30-20-8-6-7-9-31(20)22/h6-9,11-12,15,18-19,21,23-25,32-34,36H,10,13H2,1-5H3/t15-,18+,19-,21+,23-,24?,25+,28+,29+/m1/s1 |
| InChIKey | GSSRPRNZJNJTPZ-QXTBCXRUSA-N |
| XLogP | 2.43 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|