C22H33NO4 — CID 130293490
4-[6-[3-(oxan-4-yl)propoxy]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid (PubChem CID 130293490) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is 4-[6-[3-(oxan-4-yl)propoxy]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid.
| Compound Name | 4-[6-[3-(oxan-4-yl)propoxy]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 130293490 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 4-[6-[3-(oxan-4-yl)propoxy]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CCc2cccc(OCCCC3CCOCC3)c2CC1 |
| InChI | InChI=1S/C22H33NO4/c24-22(25)7-2-12-23-13-8-19-5-1-6-21(20(19)9-14-23)27-15-3-4-18-10-16-26-17-11-18/h1,5-6,18H,2-4,7-17H2,(H,24,25) |
| InChIKey | RNKWSERYNRJVPC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|