C25H28F3NO3 — CID 130293513
5-[6-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoxy]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]pentanoic acid (PubChem CID 130293513) has the molecular formula C25H28F3NO3 and a molecular weight of 447.50 g/mol. Its IUPAC name is 5-[6-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoxy]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]pentanoic acid.
| Compound Name | 5-[6-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoxy]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 130293513 |
| Molecular Formula | C25H28F3NO3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 5-[6-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoxy]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCN1CCCc2c(cccc2OC/C=C/c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C25H28F3NO3/c26-25(27,28)21-13-11-19(12-14-21)6-5-17-32-23-9-3-7-20-18-29(16-4-8-22(20)23)15-2-1-10-24(30)31/h3,5-7,9,11-14H,1-2,4,8,10,15-18H2,(H,30,31)/b6-5+ |
| InChIKey | UYGRWBIYPDURAF-AATRIKPKSA-N |
| XLogP | 5.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|