C24H31NO3 — CID 130293523
4-[7-methyl-6-(3-phenylpropoxy)-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid (PubChem CID 130293523) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-[7-methyl-6-(3-phenylpropoxy)-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid.
| Compound Name | 4-[7-methyl-6-(3-phenylpropoxy)-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 130293523 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 4-[7-methyl-6-(3-phenylpropoxy)-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid |
| SMILES | Cc1ccc2c(c1OCCCc1ccccc1)CCN(CCCC(=O)O)CC2 |
| InChI | InChI=1S/C24H31NO3/c1-19-11-12-21-13-16-25(15-5-10-23(26)27)17-14-22(21)24(19)28-18-6-9-20-7-3-2-4-8-20/h2-4,7-8,11-12H,5-6,9-10,13-18H2,1H3,(H,26,27) |
| InChIKey | UPGSKNJOXKPLSR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|