C13H26N2O2S — CID 130293559
tert-butyl N-[(1-ethylsulfanylpiperidin-4-yl)methyl]carbamate (PubChem CID 130293559) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is tert-butyl N-[(1-ethylsulfanylpiperidin-4-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(1-ethylsulfanylpiperidin-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 130293559 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | tert-butyl N-[(1-ethylsulfanylpiperidin-4-yl)methyl]carbamate |
| SMILES | CCSN1CCC(CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H26N2O2S/c1-5-18-15-8-6-11(7-9-15)10-14-12(16)17-13(2,3)4/h11H,5-10H2,1-4H3,(H,14,16) |
| InChIKey | BCPFHQOFXHGOPV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|