C32H40N2O6 — CID 130293628
[(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] 2-methylimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 130293628) has the molecular formula C32H40N2O6 and a molecular weight of 548.68 g/mol. Its IUPAC name is [(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] 2-methylimidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | [(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] 2-methylimidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 130293628 |
| Molecular Formula | C32H40N2O6 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | [(1R,4S,5S,6R,13S,14R,16R,18R)-5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] 2-methylimidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CC1=C[C@]23C(O)[C@@H](C=C4COC(C)(C)O[C@H]4[C@]2(O)[C@H]1OC(=O)c1c(C)nc2ccccn12)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C32H40N2O6/c1-16-14-31-17(2)12-21-23(29(21,4)5)20(25(31)35)13-19-15-38-30(6,7)40-27(19)32(31,37)26(16)39-28(36)24-18(3)33-22-10-8-9-11-34(22)24/h8-11,13-14,17,20-21,23,25-27,35,37H,12,15H2,1-7H3/t17-,20+,21-,23+,25?,26+,27-,31+,32-/m1/s1 |
| InChIKey | KXYGBRHGCAVIBM-BAJIMUEJSA-N |
| XLogP | 4.23 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|