C30H42N2O6 — CID 130293746
[(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-tert-butyl-3,5-dimethylpyrazole-4-carboxylate (PubChem CID 130293746) has the molecular formula C30H42N2O6 and a molecular weight of 526.67 g/mol. Its IUPAC name is [(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-tert-butyl-3,5-dimethylpyrazole-4-carboxylate.
| Compound Name | [(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-tert-butyl-3,5-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 130293746 |
| Molecular Formula | C30H42N2O6 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | [(4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-tert-butyl-3,5-dimethylpyrazole-4-carboxylate |
| SMILES | CC1=CC23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1c(C)nn(C(C)(C)C)c1C)[C@H]1[C@@H](CC3C)C1(C)C |
| InChI | InChI=1S/C30H42N2O6/c1-14-12-29-15(2)10-20-22(28(20,8)9)19(24(29)35)11-18(13-33)23(34)30(29,37)25(14)38-26(36)21-16(3)31-32(17(21)4)27(5,6)7/h11-12,15,19-20,22-23,25,33-34,37H,10,13H2,1-9H3/t15?,19-,20+,22-,23+,25-,29?,30-/m0/s1 |
| InChIKey | HVQDVZGQHGALGR-DCTXSEEMSA-N |
| XLogP | 3.25 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|