C25H31NO6 — CID 130293774
[(1S,4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11-trimethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-methylpyrrole-2-carboxylate (PubChem CID 130293774) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11-trimethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11-trimethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 130293774 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11-trimethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-methylpyrrole-2-carboxylate |
| SMILES | CC1=C[C@@]23CC[C@@H]4[C@H]([C@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1cccn1C)C3=O)C4(C)C |
| InChI | InChI=1S/C25H31NO6/c1-13-11-24-8-7-16-18(23(16,2)3)15(20(24)29)10-14(12-27)19(28)25(24,31)21(13)32-22(30)17-6-5-9-26(17)4/h5-6,9-11,15-16,18-19,21,27-28,31H,7-8,12H2,1-4H3/t15-,16+,18-,19+,21-,24+,25-/m0/s1 |
| InChIKey | KHDUQGDKKOGPLR-JZZNHOBFSA-N |
| XLogP | 1.77 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|