C14H16N2 — CID 130294702
(5Z,7Z)-5-[(1Z)-buta-1,3-dienyl]-6-methyl-9-methylidene-4H-1,3-diazecine (PubChem CID 130294702) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (5Z,7Z)-5-[(1Z)-buta-1,3-dienyl]-6-methyl-9-methylidene-4H-1,3-diazecine.
| Compound Name | (5Z,7Z)-5-[(1Z)-buta-1,3-dienyl]-6-methyl-9-methylidene-4H-1,3-diazecine |
|---|---|
| PubChem CID | 130294702 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (5Z,7Z)-5-[(1Z)-buta-1,3-dienyl]-6-methyl-9-methylidene-4H-1,3-diazecine |
| SMILES | C=C/C=C\C1=C(C)\C=C/C(=C)/C=N\C=N/C1 |
| InChI | InChI=1S/C14H16N2/c1-4-5-6-14-10-16-11-15-9-12(2)7-8-13(14)3/h4-9,11H,1-2,10H2,3H3/b6-5-,8-7-,14-13-,15-9-,16-11- |
| InChIKey | XLPHFXATKQTPHS-PXLAKKDISA-N |
| XLogP | 3.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|