C50H32N2 — CID 130295035
2-(3-fluoranthen-2-ylphenyl)-4,6-bis(4-phenylphenyl)pyrimidine (PubChem CID 130295035) has the molecular formula C50H32N2 and a molecular weight of 660.82 g/mol. Its IUPAC name is 2-(3-fluoranthen-2-ylphenyl)-4,6-bis(4-phenylphenyl)pyrimidine.
| Compound Name | 2-(3-fluoranthen-2-ylphenyl)-4,6-bis(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 130295035 |
| Molecular Formula | C50H32N2 |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 2-(3-fluoranthen-2-ylphenyl)-4,6-bis(4-phenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc(-c5cc6c7c(cccc7c5)-c5ccccc5-6)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C50H32N2/c1-3-11-33(12-4-1)35-21-25-37(26-22-35)47-32-48(38-27-23-36(24-28-38)34-13-5-2-6-14-34)52-50(51-47)41-17-9-15-39(29-41)42-30-40-16-10-20-45-43-18-7-8-19-44(43)46(31-42)49(40)45/h1-32H |
| InChIKey | REHKTTSYRZXDLI-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |