C10H15NO — CID 130295711
(3E,5Z)-1-amino-3-ethenylocta-3,5,7-trien-2-ol (PubChem CID 130295711) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3E,5Z)-1-amino-3-ethenylocta-3,5,7-trien-2-ol.
| Compound Name | (3E,5Z)-1-amino-3-ethenylocta-3,5,7-trien-2-ol |
|---|---|
| PubChem CID | 130295711 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3E,5Z)-1-amino-3-ethenylocta-3,5,7-trien-2-ol |
| SMILES | C=C/C=C\C=C(/C=C)C(O)CN |
| InChI | InChI=1S/C10H15NO/c1-3-5-6-7-9(4-2)10(12)8-11/h3-7,10,12H,1-2,8,11H2/b6-5-,9-7+ |
| InChIKey | SBANXDGASZZNEO-BZWSEGBZSA-N |
| XLogP | 1.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|