About 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine
7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine (PubChem CID 130295912) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine.
Molecular Properties
| Compound Name | 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine |
| PubChem CID | 130295912 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine |
| SMILES | CC1(N)C=NC=C2CNCC2=C1 |
| InChI | InChI=1S/C9H13N3/c1-9(10)2-7-3-11-4-8(7)5-12-6-9/h2,5-6,11H,3-4,10H2,1H3 |
| InChIKey | RJQZIQBPEUGOLM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine?
The IUPAC name of 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine (CID 130295912) is 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine.
What is the SMILES notation for 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine?
The canonical SMILES for 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine is CC1(N)C=NC=C2CNCC2=C1.
What is the InChIKey of 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine?
The InChIKey is RJQZIQBPEUGOLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-9(10)2-7-3-11-4-8(7)5-12-6-9/h2,5-6,11H,3-4,10H2,1H3.
What are the key properties of 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine?
7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine has a molecular weight of 163.22 g/mol, XLogP of 0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]azepin-7-amine is sourced from PubChem (CID 130295912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).