C9H13NO — CID 130295917
2,3,4,5,8,9-hexahydro-1,5-benzoxazepine (PubChem CID 130295917) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 2,3,4,5,8,9-hexahydro-1,5-benzoxazepine.
| Compound Name | 2,3,4,5,8,9-hexahydro-1,5-benzoxazepine |
|---|---|
| PubChem CID | 130295917 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2,3,4,5,8,9-hexahydro-1,5-benzoxazepine |
| SMILES | C1=CC2=C(CC1)OCCCN2 |
| InChI | InChI=1S/C9H13NO/c1-2-5-9-8(4-1)10-6-3-7-11-9/h1,4,10H,2-3,5-7H2 |
| InChIKey | NJWNSVBOTHMKCH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |