About 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol
5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol (PubChem CID 13029597) has the molecular formula C14H16NOS2+
and a molecular weight of 278.42 g/mol. Its IUPAC name is 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol.
Molecular Properties
| Compound Name | 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol |
| PubChem CID | 13029597 |
| Molecular Formula | C14H16NOS2+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol |
| SMILES | Oc1sc(=[N+]2CCCCC2)sc1-c1ccccc1 |
| InChI | InChI=1S/C14H15NOS2/c16-13-12(11-7-3-1-4-8-11)17-14(18-13)15-9-5-2-6-10-15/h1,3-4,7-8H,2,5-6,9-10H2/p+1 |
| InChIKey | ZVTJFEWVTLCAST-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol?
The IUPAC name of 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol (CID 13029597) is 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol.
What is the SMILES notation for 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol?
The canonical SMILES for 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol is Oc1sc(=[N+]2CCCCC2)sc1-c1ccccc1.
What is the InChIKey of 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol?
The InChIKey is ZVTJFEWVTLCAST-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H15NOS2/c16-13-12(11-7-3-1-4-8-11)17-14(18-13)15-9-5-2-6-10-15/h1,3-4,7-8H,2,5-6,9-10H2/p+1.
What are the key properties of 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol?
5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol has a molecular weight of 278.42 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-2-piperidin-1-ium-1-ylidene-1,3-dithiol-4-ol is sourced from PubChem (CID 13029597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).