C24H32F3N4OP — CID 130296032
2-N-(4-dimethylphosphorylphenyl)-4-N-[3-(3-methyl-5-methylidenecyclohexyl)propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 130296032) has the molecular formula C24H32F3N4OP and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-N-(4-dimethylphosphorylphenyl)-4-N-[3-(3-methyl-5-methylidenecyclohexyl)propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-dimethylphosphorylphenyl)-4-N-[3-(3-methyl-5-methylidenecyclohexyl)propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 130296032 |
| Molecular Formula | C24H32F3N4OP |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-N-(4-dimethylphosphorylphenyl)-4-N-[3-(3-methyl-5-methylidenecyclohexyl)propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | C=C1CC(C)CC(CCCNc2nc(Nc3ccc(P(C)(C)=O)cc3)ncc2C(F)(F)F)C1 |
| InChI | InChI=1S/C24H32F3N4OP/c1-16-12-17(2)14-18(13-16)6-5-11-28-22-21(24(25,26)27)15-29-23(31-22)30-19-7-9-20(10-8-19)33(3,4)32/h7-10,15,17-18H,1,5-6,11-14H2,2-4H3,(H2,28,29,30,31) |
| InChIKey | LXLBBORDHLLMPL-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|