C20H20N4O2S3 — CID 130296070
amino-[4-[3-amino-2-propylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]methanol (PubChem CID 130296070) has the molecular formula C20H20N4O2S3 and a molecular weight of 444.61 g/mol. Its IUPAC name is amino-[4-[3-amino-2-propylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]methanol.
| Compound Name | amino-[4-[3-amino-2-propylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 130296070 |
| Molecular Formula | C20H20N4O2S3 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | amino-[4-[3-amino-2-propylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]methanol |
| SMILES | CCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(C(N)O)cc3)c2c1N |
| InChI | InChI=1S/C20H20N4O2S3/c1-2-9-29(26)20-16(21)15-13(11-3-5-12(6-4-11)17(22)25)10-14(24-19(15)28-20)18-23-7-8-27-18/h3-8,10,17,25H,2,9,21-22H2,1H3 |
| InChIKey | ZFDALYRXJTZWBG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|