C24H23N7O2S — CID 130297146
1-[3-[[4-[(5-phenoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]pyrimidin-2-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 130297146) has the molecular formula C24H23N7O2S and a molecular weight of 473.56 g/mol. Its IUPAC name is 1-[3-[[4-[(5-phenoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]pyrimidin-2-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[4-[(5-phenoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]pyrimidin-2-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130297146 |
| Molecular Formula | C24H23N7O2S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-[3-[[4-[(5-phenoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]pyrimidin-2-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(Nc2nccc(Nc3nc4ccc(Oc5ccccc5)nc4s3)n2)C1 |
| InChI | InChI=1S/C24H23N7O2S/c1-2-21(32)31-14-6-7-16(15-31)26-23-25-13-12-19(28-23)29-24-27-18-10-11-20(30-22(18)34-24)33-17-8-4-3-5-9-17/h2-5,8-13,16H,1,6-7,14-15H2,(H2,25,26,27,28,29) |
| InChIKey | UNOXMAZMLDKOBL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|