C25H25N7O2S — CID 130297193
1-[3-[[4-[(5-phenoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]pyrimidin-2-yl]amino]azepan-1-yl]prop-2-en-1-one (PubChem CID 130297193) has the molecular formula C25H25N7O2S and a molecular weight of 487.59 g/mol. Its IUPAC name is 1-[3-[[4-[(5-phenoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]pyrimidin-2-yl]amino]azepan-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[4-[(5-phenoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]pyrimidin-2-yl]amino]azepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130297193 |
| Molecular Formula | C25H25N7O2S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1-[3-[[4-[(5-phenoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]pyrimidin-2-yl]amino]azepan-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCCC(Nc2nccc(Nc3nc4ccc(Oc5ccccc5)nc4s3)n2)C1 |
| InChI | InChI=1S/C25H25N7O2S/c1-2-22(33)32-15-7-6-8-17(16-32)27-24-26-14-13-20(29-24)30-25-28-19-11-12-21(31-23(19)35-25)34-18-9-4-3-5-10-18/h2-5,9-14,17H,1,6-8,15-16H2,(H2,26,27,28,29,30) |
| InChIKey | XKDFSKJLUFFEAS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|