C24H27N7O2S — CID 130297214
N-(2,6-dimethylphenyl)-2-[[2-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 130297214) has the molecular formula C24H27N7O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[2-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[2-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 130297214 |
| Molecular Formula | C24H27N7O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[2-[[(3R)-1-prop-2-enoylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](Nc2nccc(Nc3ncc(C(=O)Nc4c(C)cccc4C)s3)n2)C1 |
| InChI | InChI=1S/C24H27N7O2S/c1-4-20(32)31-12-6-9-17(14-31)27-23-25-11-10-19(28-23)29-24-26-13-18(34-24)22(33)30-21-15(2)7-5-8-16(21)3/h4-5,7-8,10-11,13,17H,1,6,9,12,14H2,2-3H3,(H,30,33)(H2,25,26,27,28,29)/t17-/m1/s1 |
| InChIKey | QDGTXHCHKQBECZ-QGZVFWFLSA-N |
| XLogP | 4.13 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|