C37H58O6P2 — CID 130297263
3,9-bis[2,6-bis(2,2-dimethylpropyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 130297263) has the molecular formula C37H58O6P2 and a molecular weight of 660.81 g/mol. Its IUPAC name is 3,9-bis[2,6-bis(2,2-dimethylpropyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-bis[2,6-bis(2,2-dimethylpropyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 130297263 |
| Molecular Formula | C37H58O6P2 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | 3,9-bis[2,6-bis(2,2-dimethylpropyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CC(C)(C)Cc1cccc(CC(C)(C)C)c1OP1OCC2(CO1)COP(Oc1c(CC(C)(C)C)cccc1CC(C)(C)C)OC2 |
| InChI | InChI=1S/C37H58O6P2/c1-33(2,3)19-27-15-13-16-28(20-34(4,5)6)31(27)42-44-38-23-37(24-39-44)25-40-45(41-26-37)43-32-29(21-35(7,8)9)17-14-18-30(32)22-36(10,11)12/h13-18H,19-26H2,1-12H3 |
| InChIKey | NFMLYJQAKIDKOS-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|