About 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one
6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one (PubChem CID 130297920) has the molecular formula C15H18ClNO3
and a molecular weight of 295.77 g/mol. Its IUPAC name is 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one.
Molecular Properties
| Compound Name | 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one |
| PubChem CID | 130297920 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one |
| SMILES | CCC1(CCO)C(=O)NC2(COC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H18ClNO3/c1-2-14(5-6-18)12-7-10(16)3-4-11(12)15(8-20-9-15)17-13(14)19/h3-4,7,18H,2,5-6,8-9H2,1H3,(H,17,19) |
| InChIKey | WFLPIJBPVANMGL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one?
The IUPAC name of 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one (CID 130297920) is 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one.
What is the SMILES notation for 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one?
The canonical SMILES for 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one is CCC1(CCO)C(=O)NC2(COC2)c2ccc(Cl)cc21.
What is the InChIKey of 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one?
The InChIKey is WFLPIJBPVANMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO3/c1-2-14(5-6-18)12-7-10(16)3-4-11(12)15(8-20-9-15)17-13(14)19/h3-4,7,18H,2,5-6,8-9H2,1H3,(H,17,19).
What are the key properties of 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one?
6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one has a molecular weight of 295.77 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-ethyl-4-(2-hydroxyethyl)spiro[2H-isoquinoline-1,3'-oxetane]-3-one is sourced from PubChem (CID 130297920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).