About [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol
[(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol (PubChem CID 130298590) has the molecular formula C7H13F2NO
and a molecular weight of 165.18 g/mol. Its IUPAC name is [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol |
| PubChem CID | 130298590 |
| Molecular Formula | C7H13F2NO |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol |
| SMILES | C[C@@H]1CC(F)(F)CN[C@@H]1CO |
| InChI | InChI=1S/C7H13F2NO/c1-5-2-7(8,9)4-10-6(5)3-11/h5-6,10-11H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | HUVNUUNNVSTERP-PHDIDXHHSA-N |
| XLogP | 0.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol?
The IUPAC name of [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol (CID 130298590) is [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol.
What is the SMILES notation for [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol?
The canonical SMILES for [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol is C[C@@H]1CC(F)(F)CN[C@@H]1CO.
What is the InChIKey of [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol?
The InChIKey is HUVNUUNNVSTERP-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H13F2NO/c1-5-2-7(8,9)4-10-6(5)3-11/h5-6,10-11H,2-4H2,1H3/t5-,6-/m1/s1.
What are the key properties of [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol?
[(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol has a molecular weight of 165.18 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-5,5-difluoro-3-methylpiperidin-2-yl]methanol is sourced from PubChem (CID 130298590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).