C24H23FN4O3S — CID 130298798
2-(2-tert-butylpyrazol-3-yl)-6-(4-fluorophenyl)-N-(3-methyl-2,4-dioxothiolan-3-yl)pyridine-4-carboxamide (PubChem CID 130298798) has the molecular formula C24H23FN4O3S and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-(2-tert-butylpyrazol-3-yl)-6-(4-fluorophenyl)-N-(3-methyl-2,4-dioxothiolan-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-(2-tert-butylpyrazol-3-yl)-6-(4-fluorophenyl)-N-(3-methyl-2,4-dioxothiolan-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 130298798 |
| Molecular Formula | C24H23FN4O3S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 2-(2-tert-butylpyrazol-3-yl)-6-(4-fluorophenyl)-N-(3-methyl-2,4-dioxothiolan-3-yl)pyridine-4-carboxamide |
| SMILES | CC1(NC(=O)c2cc(-c3ccc(F)cc3)nc(-c3ccnn3C(C)(C)C)c2)C(=O)CSC1=O |
| InChI | InChI=1S/C24H23FN4O3S/c1-23(2,3)29-19(9-10-26-29)18-12-15(11-17(27-18)14-5-7-16(25)8-6-14)21(31)28-24(4)20(30)13-33-22(24)32/h5-12H,13H2,1-4H3,(H,28,31) |
| InChIKey | NKUOSQJAGIVZSK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|