C22H19N5O5 — CID 130298877
methyl 3-[6-carbamoyl-2-(4-ethoxyphenyl)-8-oxo-7H-purin-9-yl]benzoate (PubChem CID 130298877) has the molecular formula C22H19N5O5 and a molecular weight of 433.42 g/mol. Its IUPAC name is methyl 3-[6-carbamoyl-2-(4-ethoxyphenyl)-8-oxo-7H-purin-9-yl]benzoate.
| Compound Name | methyl 3-[6-carbamoyl-2-(4-ethoxyphenyl)-8-oxo-7H-purin-9-yl]benzoate |
|---|---|
| PubChem CID | 130298877 |
| Molecular Formula | C22H19N5O5 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | methyl 3-[6-carbamoyl-2-(4-ethoxyphenyl)-8-oxo-7H-purin-9-yl]benzoate |
| SMILES | CCOc1ccc(-c2nc(C(N)=O)c3[nH]c(=O)n(-c4cccc(C(=O)OC)c4)c3n2)cc1 |
| InChI | InChI=1S/C22H19N5O5/c1-3-32-15-9-7-12(8-10-15)19-24-16(18(23)28)17-20(26-19)27(22(30)25-17)14-6-4-5-13(11-14)21(29)31-2/h4-11H,3H2,1-2H3,(H2,23,28)(H,25,30) |
| InChIKey | ZKQISIFOAUWQFD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |