About 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one
5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one (PubChem CID 130298979) has the molecular formula C6H9NO
and a molecular weight of 114.16 g/mol. Its IUPAC name is 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one.
Molecular Properties
| Compound Name | 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one |
| PubChem CID | 130298979 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 114.16 g/mol |
| Exact Mass | 114.09 |
| IUPAC Name | 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one |
| SMILES | [2H]C([2H])([2H])C1C=NCCC1=O |
| InChI | InChI=1S/C6H9NO/c1-5-4-7-3-2-6(5)8/h4-5H,2-3H2,1H3/i1D3 |
| InChIKey | NJYJFHNCALUTOT-FIBGUPNXSA-N |
| XLogP | 0.67 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one?
The IUPAC name of 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one (CID 130298979) is 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one.
What is the SMILES notation for 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one?
The canonical SMILES for 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one is [2H]C([2H])([2H])C1C=NCCC1=O.
What is the InChIKey of 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one?
The InChIKey is NJYJFHNCALUTOT-FIBGUPNXSA-N. The full InChI is InChI=1S/C6H9NO/c1-5-4-7-3-2-6(5)8/h4-5H,2-3H2,1H3/i1D3.
What are the key properties of 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one?
5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one has a molecular weight of 114.16 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trideuteriomethyl)-3,5-dihydro-2H-pyridin-4-one is sourced from PubChem (CID 130298979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).