About (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine
(3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine (PubChem CID 130298993) has the molecular formula C6H10N2
and a molecular weight of 113.18 g/mol. Its IUPAC name is (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine |
| PubChem CID | 130298993 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine |
| SMILES | [2H]C([2H])([2H])C1=C[C@H](N)CN=C1 |
| InChI | InChI=1S/C6H10N2/c1-5-2-6(7)4-8-3-5/h2-3,6H,4,7H2,1H3/t6-/m0/s1/i1D3 |
| InChIKey | MIRBGVDLNQVFEH-FYFSCIFKSA-N |
| XLogP | 0.34 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine?
The IUPAC name of (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine (CID 130298993) is (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine.
What is the SMILES notation for (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine?
The canonical SMILES for (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine is [2H]C([2H])([2H])C1=C[C@H](N)CN=C1.
What is the InChIKey of (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine?
The InChIKey is MIRBGVDLNQVFEH-FYFSCIFKSA-N. The full InChI is InChI=1S/C6H10N2/c1-5-2-6(7)4-8-3-5/h2-3,6H,4,7H2,1H3/t6-/m0/s1/i1D3.
What are the key properties of (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine?
(3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine has a molecular weight of 113.18 g/mol, XLogP of 0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-(trideuteriomethyl)-2,3-dihydropyridin-3-amine is sourced from PubChem (CID 130298993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).