C11H12N2O2S — CID 130299102
(2-sulfanylidene-1,3,4,5-tetrahydro-1-benzazepin-3-yl)carbamic acid (PubChem CID 130299102) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is (2-sulfanylidene-1,3,4,5-tetrahydro-1-benzazepin-3-yl)carbamic acid.
| Compound Name | (2-sulfanylidene-1,3,4,5-tetrahydro-1-benzazepin-3-yl)carbamic acid |
|---|---|
| PubChem CID | 130299102 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | (2-sulfanylidene-1,3,4,5-tetrahydro-1-benzazepin-3-yl)carbamic acid |
| SMILES | O=C(O)NC1CCc2ccccc2NC1=S |
| InChI | InChI=1S/C11H12N2O2S/c14-11(15)13-9-6-5-7-3-1-2-4-8(7)12-10(9)16/h1-4,9,13H,5-6H2,(H,12,16)(H,14,15) |
| InChIKey | SIRORORIAGCTOV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|