C14H17F3N2O6S3 — CID 130300271
ethyl 1-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)oxymethyl]-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate (PubChem CID 130300271) has the molecular formula C14H17F3N2O6S3 and a molecular weight of 462.49 g/mol. Its IUPAC name is ethyl 1-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)oxymethyl]-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 1-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)oxymethyl]-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 130300271 |
| Molecular Formula | C14H17F3N2O6S3 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | ethyl 1-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)oxymethyl]-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(COc2nsc(SC)n2)CC=C(OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H17F3N2O6S3/c1-3-23-10(20)13(8-24-11-18-12(26-2)27-19-11)6-4-9(5-7-13)25-28(21,22)14(15,16)17/h4H,3,5-8H2,1-2H3 |
| InChIKey | FOJIZFBZKMTEQC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|