About 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole
7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole (PubChem CID 130300326) has the molecular formula C25H22N2S
and a molecular weight of 382.53 g/mol. Its IUPAC name is 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole.
Molecular Properties
| Compound Name | 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole |
| PubChem CID | 130300326 |
| Molecular Formula | C25H22N2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole |
| SMILES | CC1=C(c2ccccc2)C(CCc2ccc(-c3ccsc3)cc2)n2cncc21 |
| InChI | InChI=1S/C25H22N2S/c1-18-24-15-26-17-27(24)23(25(18)21-5-3-2-4-6-21)12-9-19-7-10-20(11-8-19)22-13-14-28-16-22/h2-8,10-11,13-17,23H,9,12H2,1H3 |
| InChIKey | ZFBWEHZVFITPID-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole?
The IUPAC name of 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole (CID 130300326) is 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole.
What is the SMILES notation for 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole?
The canonical SMILES for 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole is CC1=C(c2ccccc2)C(CCc2ccc(-c3ccsc3)cc2)n2cncc21.
What is the InChIKey of 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole?
The InChIKey is ZFBWEHZVFITPID-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2S/c1-18-24-15-26-17-27(24)23(25(18)21-5-3-2-4-6-21)12-9-19-7-10-20(11-8-19)22-13-14-28-16-22/h2-8,10-11,13-17,23H,9,12H2,1H3.
What are the key properties of 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole?
7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole has a molecular weight of 382.53 g/mol, XLogP of 6.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6-phenyl-5-[2-(4-thiophen-3-ylphenyl)ethyl]-5H-pyrrolo[1,2-c]imidazole is sourced from PubChem (CID 130300326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).