About 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole
5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole (PubChem CID 130300460) has the molecular formula C21H24F2N2
and a molecular weight of 342.43 g/mol. Its IUPAC name is 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole.
Molecular Properties
| Compound Name | 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole |
| PubChem CID | 130300460 |
| Molecular Formula | C21H24F2N2 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole |
| SMILES | CC1=C(c2ccccc2)C(CCC2CCC(F)(F)CC2)n2cncc21 |
| InChI | InChI=1S/C21H24F2N2/c1-15-19-13-24-14-25(19)18(20(15)17-5-3-2-4-6-17)8-7-16-9-11-21(22,23)12-10-16/h2-6,13-14,16,18H,7-12H2,1H3 |
| InChIKey | SEOIFQFGNGALIY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole?
The IUPAC name of 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole (CID 130300460) is 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole.
What is the SMILES notation for 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole?
The canonical SMILES for 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole is CC1=C(c2ccccc2)C(CCC2CCC(F)(F)CC2)n2cncc21.
What is the InChIKey of 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole?
The InChIKey is SEOIFQFGNGALIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2N2/c1-15-19-13-24-14-25(19)18(20(15)17-5-3-2-4-6-17)8-7-16-9-11-21(22,23)12-10-16/h2-6,13-14,16,18H,7-12H2,1H3.
What are the key properties of 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole?
5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole has a molecular weight of 342.43 g/mol, XLogP of 5.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4,4-difluorocyclohexyl)ethyl]-7-methyl-6-phenyl-5H-pyrrolo[1,2-c]imidazole is sourced from PubChem (CID 130300460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).